C24H22F6S — CID 139924097
bis(4-ethylphenyl)-fluoro-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-λ4-sulfane (PubChem CID 139924097) has the molecular formula C24H22F6S and a molecular weight of 456.50 g/mol. Its IUPAC name is bis(4-ethylphenyl)-fluoro-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-λ4-sulfane.
| Compound Name | bis(4-ethylphenyl)-fluoro-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-λ4-sulfane |
|---|---|
| PubChem CID | 139924097 |
| Molecular Formula | C24H22F6S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | bis(4-ethylphenyl)-fluoro-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-λ4-sulfane |
| SMILES | CCc1ccc(S(F)(c2ccc(CC)cc2)c2cccc(C(F)(F)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H22F6S/c1-3-17-8-12-20(13-9-17)31(30,21-14-10-18(4-2)11-15-21)22-7-5-6-19(16-22)23(25,26)24(27,28)29/h5-16H,3-4H2,1-2H3 |
| InChIKey | FGYBUENOJPAGGI-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|