C33H36Cl3N3 — CID 139924679
4-[2-[3,5-bis[2-(4-amino-3-chlorophenyl)propan-2-yl]phenyl]propan-2-yl]-2-chloroaniline (PubChem CID 139924679) has the molecular formula C33H36Cl3N3 and a molecular weight of 581.03 g/mol. Its IUPAC name is 4-[2-[3,5-bis[2-(4-amino-3-chlorophenyl)propan-2-yl]phenyl]propan-2-yl]-2-chloroaniline.
| Compound Name | 4-[2-[3,5-bis[2-(4-amino-3-chlorophenyl)propan-2-yl]phenyl]propan-2-yl]-2-chloroaniline |
|---|---|
| PubChem CID | 139924679 |
| Molecular Formula | C33H36Cl3N3 |
| Molecular Weight | 581.03 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | 4-[2-[3,5-bis[2-(4-amino-3-chlorophenyl)propan-2-yl]phenyl]propan-2-yl]-2-chloroaniline |
| SMILES | CC(C)(c1cc(C(C)(C)c2ccc(N)c(Cl)c2)cc(C(C)(C)c2ccc(N)c(Cl)c2)c1)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C33H36Cl3N3/c1-31(2,19-7-10-28(37)25(34)16-19)22-13-23(32(3,4)20-8-11-29(38)26(35)17-20)15-24(14-22)33(5,6)21-9-12-30(39)27(36)18-21/h7-18H,37-39H2,1-6H3 |
| InChIKey | GURDZOAKKQETFE-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.03 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|