C12H15NO2S — CID 139924961
(4R)-4-benzyl-3-[(1R)-1-sulfanylethyl]-1,3-oxazolidin-2-one (PubChem CID 139924961) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(1R)-1-sulfanylethyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(1R)-1-sulfanylethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139924961 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (4R)-4-benzyl-3-[(1R)-1-sulfanylethyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](S)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C12H15NO2S/c1-9(16)13-11(8-15-12(13)14)7-10-5-3-2-4-6-10/h2-6,9,11,16H,7-8H2,1H3/t9-,11-/m1/s1 |
| InChIKey | BAXHWEVVKQUCPI-MWLCHTKSSA-N |
| XLogP | 2.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|