C36H46O7 — CID 139924976
1-[4-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]phenoxy]-3,3-dimethylbutan-2-one (PubChem CID 139924976) has the molecular formula C36H46O7 and a molecular weight of 590.76 g/mol. Its IUPAC name is 1-[4-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]phenoxy]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[4-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]phenoxy]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 139924976 |
| Molecular Formula | C36H46O7 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | 1-[4-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]phenoxy]-3,3-dimethylbutan-2-one |
| SMILES | COCOc1ccc(C2(C)COc3cc(OCOC)ccc3C2CCCCc2ccc(OCC(=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H46O7/c1-35(2,3)34(37)22-40-28-15-11-26(12-16-28)9-7-8-10-32-31-20-19-30(43-25-39-6)21-33(31)41-23-36(32,4)27-13-17-29(18-14-27)42-24-38-5/h11-21,32H,7-10,22-25H2,1-6H3 |
| InChIKey | KLLYOCLTSCVIHM-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|