About 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one
4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one (PubChem CID 139925600) has the molecular formula C16H32N2O3
and a molecular weight of 300.44 g/mol. Its IUPAC name is 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one.
Molecular Properties
| Compound Name | 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one |
| PubChem CID | 139925600 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one |
| SMILES | CCC1N(CCOC)C(=O)N(CCOC)C1(CC)C(C)C |
| InChI | InChI=1S/C16H32N2O3/c1-7-14-16(8-2,13(3)4)18(10-12-21-6)15(19)17(14)9-11-20-5/h13-14H,7-12H2,1-6H3 |
| InChIKey | YQWNRRPNUSINPJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one?
The IUPAC name of 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one (CID 139925600) is 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one.
What is the SMILES notation for 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one?
The canonical SMILES for 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one is CCC1N(CCOC)C(=O)N(CCOC)C1(CC)C(C)C.
What is the InChIKey of 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one?
The InChIKey is YQWNRRPNUSINPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O3/c1-7-14-16(8-2,13(3)4)18(10-12-21-6)15(19)17(14)9-11-20-5/h13-14H,7-12H2,1-6H3.
What are the key properties of 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one?
4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one has a molecular weight of 300.44 g/mol, XLogP of 2.60, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethyl-1,3-bis(2-methoxyethyl)-4-propan-2-ylimidazolidin-2-one is sourced from PubChem (CID 139925600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).