C15H30N2O3 — CID 139925609
4,4,5-triethyl-1,3-bis(2-methoxyethyl)imidazolidin-2-one (PubChem CID 139925609) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is 4,4,5-triethyl-1,3-bis(2-methoxyethyl)imidazolidin-2-one.
| Compound Name | 4,4,5-triethyl-1,3-bis(2-methoxyethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 139925609 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 4,4,5-triethyl-1,3-bis(2-methoxyethyl)imidazolidin-2-one |
| SMILES | CCC1N(CCOC)C(=O)N(CCOC)C1(CC)CC |
| InChI | InChI=1S/C15H30N2O3/c1-6-13-15(7-2,8-3)17(10-12-20-5)14(18)16(13)9-11-19-4/h13H,6-12H2,1-5H3 |
| InChIKey | NHSIVRMFMTXWAC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |