C13H20Cl2F4N2O3 — CID 139925610
4,5-dichloro-4,5-difluoro-1,3-bis(1-fluoro-2-methoxybutyl)imidazolidin-2-one (PubChem CID 139925610) has the molecular formula C13H20Cl2F4N2O3 and a molecular weight of 399.21 g/mol. Its IUPAC name is 4,5-dichloro-4,5-difluoro-1,3-bis(1-fluoro-2-methoxybutyl)imidazolidin-2-one.
| Compound Name | 4,5-dichloro-4,5-difluoro-1,3-bis(1-fluoro-2-methoxybutyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 139925610 |
| Molecular Formula | C13H20Cl2F4N2O3 |
| Molecular Weight | 399.21 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 4,5-dichloro-4,5-difluoro-1,3-bis(1-fluoro-2-methoxybutyl)imidazolidin-2-one |
| SMILES | CCC(OC)C(F)N1C(=O)N(C(F)C(CC)OC)C(F)(Cl)C1(F)Cl |
| InChI | InChI=1S/C13H20Cl2F4N2O3/c1-5-7(23-3)9(16)20-11(22)21(10(17)8(6-2)24-4)13(15,19)12(20,14)18/h7-10H,5-6H2,1-4H3 |
| InChIKey | PQUZYYHXDMVSPB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|