C18H25F11N2O3 — CID 139925686
1,3-bis(1-fluoro-2-methoxyethyl)-4,4,5-tris(1,1,1-trifluoropropan-2-yl)imidazolidin-2-one (PubChem CID 139925686) has the molecular formula C18H25F11N2O3 and a molecular weight of 526.39 g/mol. Its IUPAC name is 1,3-bis(1-fluoro-2-methoxyethyl)-4,4,5-tris(1,1,1-trifluoropropan-2-yl)imidazolidin-2-one.
| Compound Name | 1,3-bis(1-fluoro-2-methoxyethyl)-4,4,5-tris(1,1,1-trifluoropropan-2-yl)imidazolidin-2-one |
|---|---|
| PubChem CID | 139925686 |
| Molecular Formula | C18H25F11N2O3 |
| Molecular Weight | 526.39 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 1,3-bis(1-fluoro-2-methoxyethyl)-4,4,5-tris(1,1,1-trifluoropropan-2-yl)imidazolidin-2-one |
| SMILES | COCC(F)N1C(=O)N(C(F)COC)C(C(C)C(F)(F)F)(C(C)C(F)(F)F)C1C(C)C(F)(F)F |
| InChI | InChI=1S/C18H25F11N2O3/c1-8(16(21,22)23)13-15(9(2)17(24,25)26,10(3)18(27,28)29)31(12(20)7-34-5)14(32)30(13)11(19)6-33-4/h8-13H,6-7H2,1-5H3 |
| InChIKey | KIEZGLAPIXQYFE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|