C17H19F15N2O3 — CID 139925698
1,3-bis(2-methoxypropyl)-4,4,5-tris(1,1,2,2,2-pentafluoroethyl)imidazolidin-2-one (PubChem CID 139925698) has the molecular formula C17H19F15N2O3 and a molecular weight of 584.32 g/mol. Its IUPAC name is 1,3-bis(2-methoxypropyl)-4,4,5-tris(1,1,2,2,2-pentafluoroethyl)imidazolidin-2-one.
| Compound Name | 1,3-bis(2-methoxypropyl)-4,4,5-tris(1,1,2,2,2-pentafluoroethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 139925698 |
| Molecular Formula | C17H19F15N2O3 |
| Molecular Weight | 584.32 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | 1,3-bis(2-methoxypropyl)-4,4,5-tris(1,1,2,2,2-pentafluoroethyl)imidazolidin-2-one |
| SMILES | COC(C)CN1C(=O)N(CC(C)OC)C(C(F)(F)C(F)(F)F)(C(F)(F)C(F)(F)F)C1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H19F15N2O3/c1-7(36-3)5-33-9(12(18,19)15(24,25)26)11(13(20,21)16(27,28)29,14(22,23)17(30,31)32)34(10(33)35)6-8(2)37-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | JAHWLASJMKDYQR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.32 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|