About 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one
1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one (PubChem CID 139925734) has the molecular formula C15H24F6N2O3
and a molecular weight of 394.36 g/mol. Its IUPAC name is 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one |
| PubChem CID | 139925734 |
| Molecular Formula | C15H24F6N2O3 |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one |
| SMILES | CCC(CN1CC(C(F)(F)F)(C(F)(F)F)N(CC(CC)OC)C1=O)OC |
| InChI | InChI=1S/C15H24F6N2O3/c1-5-10(25-3)7-22-9-13(14(16,17)18,15(19,20)21)23(12(22)24)8-11(6-2)26-4/h10-11H,5-9H2,1-4H3 |
| InChIKey | BSQIATANBGIMNF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one?
The IUPAC name of 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one (CID 139925734) is 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one.
What is the SMILES notation for 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one?
The canonical SMILES for 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one is CCC(CN1CC(C(F)(F)F)(C(F)(F)F)N(CC(CC)OC)C1=O)OC.
What is the InChIKey of 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one?
The InChIKey is BSQIATANBGIMNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F6N2O3/c1-5-10(25-3)7-22-9-13(14(16,17)18,15(19,20)21)23(12(22)24)8-11(6-2)26-4/h10-11H,5-9H2,1-4H3.
What are the key properties of 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one?
1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one has a molecular weight of 394.36 g/mol, XLogP of 3.44, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2-methoxybutyl)-4,4-bis(trifluoromethyl)imidazolidin-2-one is sourced from PubChem (CID 139925734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).