C13H26N2O3 — CID 139925751
1,3-bis(2-propoxyethyl)imidazolidin-2-one (PubChem CID 139925751) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1,3-bis(2-propoxyethyl)imidazolidin-2-one.
| Compound Name | 1,3-bis(2-propoxyethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 139925751 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 1,3-bis(2-propoxyethyl)imidazolidin-2-one |
| SMILES | CCCOCCN1CCN(CCOCCC)C1=O |
| InChI | InChI=1S/C13H26N2O3/c1-3-9-17-11-7-14-5-6-15(13(14)16)8-12-18-10-4-2/h3-12H2,1-2H3 |
| InChIKey | AOTWQWTVOKESKY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|