C17H23F2N3O3 — CID 139926238
(4S)-4-amino-N-[2-(diethylamino)-2-oxoethyl]-2,2-difluoro-3-oxo-5-phenylpentanamide (PubChem CID 139926238) has the molecular formula C17H23F2N3O3 and a molecular weight of 355.39 g/mol. Its IUPAC name is (4S)-4-amino-N-[2-(diethylamino)-2-oxoethyl]-2,2-difluoro-3-oxo-5-phenylpentanamide.
| Compound Name | (4S)-4-amino-N-[2-(diethylamino)-2-oxoethyl]-2,2-difluoro-3-oxo-5-phenylpentanamide |
|---|---|
| PubChem CID | 139926238 |
| Molecular Formula | C17H23F2N3O3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (4S)-4-amino-N-[2-(diethylamino)-2-oxoethyl]-2,2-difluoro-3-oxo-5-phenylpentanamide |
| SMILES | CCN(CC)C(=O)CNC(=O)C(F)(F)C(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C17H23F2N3O3/c1-3-22(4-2)14(23)11-21-16(25)17(18,19)15(24)13(20)10-12-8-6-5-7-9-12/h5-9,13H,3-4,10-11,20H2,1-2H3,(H,21,25)/t13-/m0/s1 |
| InChIKey | NHBAHCMZPXMECP-ZDUSSCGKSA-N |
| XLogP | 0.75 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|