C10H17NO — CID 139928311
2-ethoxy-1,2,3,5,6,8a-hexahydroindolizine (PubChem CID 139928311) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-ethoxy-1,2,3,5,6,8a-hexahydroindolizine.
| Compound Name | 2-ethoxy-1,2,3,5,6,8a-hexahydroindolizine |
|---|---|
| PubChem CID | 139928311 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-ethoxy-1,2,3,5,6,8a-hexahydroindolizine |
| SMILES | CCOC1CC2C=CCCN2C1 |
| InChI | InChI=1S/C10H17NO/c1-2-12-10-7-9-5-3-4-6-11(9)8-10/h3,5,9-10H,2,4,6-8H2,1H3 |
| InChIKey | PKSPRQMASRFVRU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|