C5H12N6O3 — CID 139928356
[(4,6-diamino-1,3,5-triazin-2-yl)-(hydroxymethyl)amino]methanol;hydrate (PubChem CID 139928356) has the molecular formula C5H12N6O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is [(4,6-diamino-1,3,5-triazin-2-yl)-(hydroxymethyl)amino]methanol;hydrate.
| Compound Name | [(4,6-diamino-1,3,5-triazin-2-yl)-(hydroxymethyl)amino]methanol;hydrate |
|---|---|
| PubChem CID | 139928356 |
| Molecular Formula | C5H12N6O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | [(4,6-diamino-1,3,5-triazin-2-yl)-(hydroxymethyl)amino]methanol;hydrate |
| SMILES | Nc1nc(N)nc(N(CO)CO)n1.O |
| InChI | InChI=1S/C5H10N6O2.H2O/c6-3-8-4(7)10-5(9-3)11(1-12)2-13;/h12-13H,1-2H2,(H4,6,7,8,9,10);1H2 |
| InChIKey | MPMFSLAUKSWPLL-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 165.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|