C20H22ClNO4 — CID 139929146
2-[(8S)-5-chloro-13,14,15-trimethoxy-8-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl]acetamide (PubChem CID 139929146) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is 2-[(8S)-5-chloro-13,14,15-trimethoxy-8-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl]acetamide.
| Compound Name | 2-[(8S)-5-chloro-13,14,15-trimethoxy-8-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl]acetamide |
|---|---|
| PubChem CID | 139929146 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-[(8S)-5-chloro-13,14,15-trimethoxy-8-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl]acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(Cl)cc1[C@H](CC(N)=O)CC2 |
| InChI | InChI=1S/C20H22ClNO4/c1-24-16-8-12-5-4-11(9-17(22)23)15-10-13(21)6-7-14(15)18(12)20(26-3)19(16)25-2/h6-8,10-11H,4-5,9H2,1-3H3,(H2,22,23)/t11-/m0/s1 |
| InChIKey | MSWHKMRDHYIPPM-NSHDSACASA-N |
| XLogP | 3.94 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |