C24H30O2 — CID 139929966
2-ethyl-9,10-bis[(2-methylpropan-2-yl)oxy]anthracene (PubChem CID 139929966) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is 2-ethyl-9,10-bis[(2-methylpropan-2-yl)oxy]anthracene.
| Compound Name | 2-ethyl-9,10-bis[(2-methylpropan-2-yl)oxy]anthracene |
|---|---|
| PubChem CID | 139929966 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 2-ethyl-9,10-bis[(2-methylpropan-2-yl)oxy]anthracene |
| SMILES | CCc1ccc2c(OC(C)(C)C)c3ccccc3c(OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C24H30O2/c1-8-16-13-14-19-20(15-16)22(26-24(5,6)7)18-12-10-9-11-17(18)21(19)25-23(2,3)4/h9-15H,8H2,1-7H3 |
| InChIKey | VOHMFVZQNUBSON-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|