C19H42N2 — CID 139931025
1-N,2-N-dioctylpropane-1,2-diamine (PubChem CID 139931025) has the molecular formula C19H42N2 and a molecular weight of 298.56 g/mol. Its IUPAC name is 1-N,2-N-dioctylpropane-1,2-diamine.
| Compound Name | 1-N,2-N-dioctylpropane-1,2-diamine |
|---|---|
| PubChem CID | 139931025 |
| Molecular Formula | C19H42N2 |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.33 |
| IUPAC Name | 1-N,2-N-dioctylpropane-1,2-diamine |
| SMILES | CCCCCCCCNCC(C)NCCCCCCCC |
| InChI | InChI=1S/C19H42N2/c1-4-6-8-10-12-14-16-20-18-19(3)21-17-15-13-11-9-7-5-2/h19-21H,4-18H2,1-3H3 |
| InChIKey | LZGMHEPCPBMEJN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|