C26H30BrFN4O7 — CID 139931545
1-[(1R,2R)-2-[2-[[(3R,4R)-4-amino-4-[(2R)-butan-2-yl]-5-oxodioxolan-3-yl]oxymethoxy]-6-fluoro-3-propanoylphenyl]cyclopropyl]-3-(5-bromo-2-pyridinyl)urea (PubChem CID 139931545) has the molecular formula C26H30BrFN4O7 and a molecular weight of 609.45 g/mol. Its IUPAC name is 1-[(1R,2R)-2-[2-[[(3R,4R)-4-amino-4-[(2R)-butan-2-yl]-5-oxodioxolan-3-yl]oxymethoxy]-6-fluoro-3-propanoylphenyl]cyclopropyl]-3-(5-bromo-2-pyridinyl)urea.
| Compound Name | 1-[(1R,2R)-2-[2-[[(3R,4R)-4-amino-4-[(2R)-butan-2-yl]-5-oxodioxolan-3-yl]oxymethoxy]-6-fluoro-3-propanoylphenyl]cyclopropyl]-3-(5-bromo-2-pyridinyl)urea |
|---|---|
| PubChem CID | 139931545 |
| Molecular Formula | C26H30BrFN4O7 |
| Molecular Weight | 609.45 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | 1-[(1R,2R)-2-[2-[[(3R,4R)-4-amino-4-[(2R)-butan-2-yl]-5-oxodioxolan-3-yl]oxymethoxy]-6-fluoro-3-propanoylphenyl]cyclopropyl]-3-(5-bromo-2-pyridinyl)urea |
| SMILES | CCC(=O)c1ccc(F)c([C@H]2C[C@H]2NC(=O)Nc2ccc(Br)cn2)c1OCO[C@@H]1OOC(=O)[C@@]1(N)[C@H](C)CC |
| InChI | InChI=1S/C26H30BrFN4O7/c1-4-13(3)26(29)23(34)38-39-24(26)37-12-36-22-15(19(33)5-2)7-8-17(28)21(22)16-10-18(16)31-25(35)32-20-9-6-14(27)11-30-20/h6-9,11,13,16,18,24H,4-5,10,12,29H2,1-3H3,(H2,30,31,32,35)/t13-,16+,18-,24-,26+/m1/s1 |
| InChIKey | PHULGGXTLKFBCK-DWNNRBLKSA-N |
| XLogP | 4.16 |
| TPSA | 151.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|