C28H40ClN3O2S — CID 139931609
2-chloro-N-[3-[(4S,5S)-3,3-dibutyl-7-(dimethylamino)-4-hydroxy-2-methyl-4,5-dihydro-1,2-benzothiazepin-5-yl]phenyl]acetamide (PubChem CID 139931609) has the molecular formula C28H40ClN3O2S and a molecular weight of 518.17 g/mol. Its IUPAC name is 2-chloro-N-[3-[(4S,5S)-3,3-dibutyl-7-(dimethylamino)-4-hydroxy-2-methyl-4,5-dihydro-1,2-benzothiazepin-5-yl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[3-[(4S,5S)-3,3-dibutyl-7-(dimethylamino)-4-hydroxy-2-methyl-4,5-dihydro-1,2-benzothiazepin-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 139931609 |
| Molecular Formula | C28H40ClN3O2S |
| Molecular Weight | 518.17 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 2-chloro-N-[3-[(4S,5S)-3,3-dibutyl-7-(dimethylamino)-4-hydroxy-2-methyl-4,5-dihydro-1,2-benzothiazepin-5-yl]phenyl]acetamide |
| SMILES | CCCCC1(CCCC)[C@@H](O)[C@@H](c2cccc(NC(=O)CCl)c2)c2cc(N(C)C)ccc2SN1C |
| InChI | InChI=1S/C28H40ClN3O2S/c1-6-8-15-28(16-9-7-2)27(34)26(20-11-10-12-21(17-20)30-25(33)19-29)23-18-22(31(3)4)13-14-24(23)35-32(28)5/h10-14,17-18,26-27,34H,6-9,15-16,19H2,1-5H3,(H,30,33)/t26-,27-/m0/s1 |
| InChIKey | HNLYTDOFASBGJQ-SVBPBHIXSA-N |
| XLogP | 6.49 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.17 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|