C24H25ClN8O — CID 139931624
1-[5-[(3,7-diphenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxymethyl]-2-methyl-1,2,4-triazol-3-yl]-N,N-dimethylmethanamine;hydrochloride (PubChem CID 139931624) has the molecular formula C24H25ClN8O and a molecular weight of 476.97 g/mol. Its IUPAC name is 1-[5-[(3,7-diphenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxymethyl]-2-methyl-1,2,4-triazol-3-yl]-N,N-dimethylmethanamine;hydrochloride.
| Compound Name | 1-[5-[(3,7-diphenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxymethyl]-2-methyl-1,2,4-triazol-3-yl]-N,N-dimethylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 139931624 |
| Molecular Formula | C24H25ClN8O |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 1-[5-[(3,7-diphenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxymethyl]-2-methyl-1,2,4-triazol-3-yl]-N,N-dimethylmethanamine;hydrochloride |
| SMILES | CN(C)Cc1nc(COc2nn3c(-c4ccccc4)nnc3cc2-c2ccccc2)nn1C.Cl |
| InChI | InChI=1S/C24H24N8O.ClH/c1-30(2)15-22-25-20(28-31(22)3)16-33-24-19(17-10-6-4-7-11-17)14-21-26-27-23(32(21)29-24)18-12-8-5-9-13-18;/h4-14H,15-16H2,1-3H3;1H |
| InChIKey | YUXKNYXKBOQCDO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |