C26H23NO5 — CID 139932337
(2,8-dimethoxy-6H-isoindolo[2,1-a]indol-11-yl)-[4-(methoxymethoxy)phenyl]methanone (PubChem CID 139932337) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is (2,8-dimethoxy-6H-isoindolo[2,1-a]indol-11-yl)-[4-(methoxymethoxy)phenyl]methanone.
| Compound Name | (2,8-dimethoxy-6H-isoindolo[2,1-a]indol-11-yl)-[4-(methoxymethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 139932337 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (2,8-dimethoxy-6H-isoindolo[2,1-a]indol-11-yl)-[4-(methoxymethoxy)phenyl]methanone |
| SMILES | COCOc1ccc(C(=O)c2c3n(c4ccc(OC)cc24)Cc2cc(OC)ccc2-3)cc1 |
| InChI | InChI=1S/C26H23NO5/c1-29-15-32-18-6-4-16(5-7-18)26(28)24-22-13-20(31-3)9-11-23(22)27-14-17-12-19(30-2)8-10-21(17)25(24)27/h4-13H,14-15H2,1-3H3 |
| InChIKey | DTFWKFYJYORJPX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|