C15H30F2N2O2 — CID 139932593
4,5-diethyl-2,2-difluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidine (PubChem CID 139932593) has the molecular formula C15H30F2N2O2 and a molecular weight of 308.41 g/mol. Its IUPAC name is 4,5-diethyl-2,2-difluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidine.
| Compound Name | 4,5-diethyl-2,2-difluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidine |
|---|---|
| PubChem CID | 139932593 |
| Molecular Formula | C15H30F2N2O2 |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 4,5-diethyl-2,2-difluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidine |
| SMILES | CCC1(C)N(CCOC)C(F)(F)N(CCOC)C1(C)CC |
| InChI | InChI=1S/C15H30F2N2O2/c1-7-13(3)14(4,8-2)19(10-12-21-6)15(16,17)18(13)9-11-20-5/h7-12H2,1-6H3 |
| InChIKey | XEVHYNSTSSDXOW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|