C21H42F2N2O2 — CID 139932598
2,2-difluoro-1,3-bis(4-methoxyhexan-3-yl)-4,4,5,5-tetramethylimidazolidine (PubChem CID 139932598) has the molecular formula C21H42F2N2O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is 2,2-difluoro-1,3-bis(4-methoxyhexan-3-yl)-4,4,5,5-tetramethylimidazolidine.
| Compound Name | 2,2-difluoro-1,3-bis(4-methoxyhexan-3-yl)-4,4,5,5-tetramethylimidazolidine |
|---|---|
| PubChem CID | 139932598 |
| Molecular Formula | C21H42F2N2O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | 2,2-difluoro-1,3-bis(4-methoxyhexan-3-yl)-4,4,5,5-tetramethylimidazolidine |
| SMILES | CCC(OC)C(CC)N1C(F)(F)N(C(CC)C(CC)OC)C(C)(C)C1(C)C |
| InChI | InChI=1S/C21H42F2N2O2/c1-11-15(17(13-3)26-9)24-19(5,6)20(7,8)25(21(24,22)23)16(12-2)18(14-4)27-10/h15-18H,11-14H2,1-10H3 |
| InChIKey | YNRWUOGDOUDAMJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|