C18H34F4N2O2 — CID 139932609
2,2-difluoro-1,3-bis(1-fluoro-2-methoxyethyl)-4,4,5-tripropylimidazolidine (PubChem CID 139932609) has the molecular formula C18H34F4N2O2 and a molecular weight of 386.47 g/mol. Its IUPAC name is 2,2-difluoro-1,3-bis(1-fluoro-2-methoxyethyl)-4,4,5-tripropylimidazolidine.
| Compound Name | 2,2-difluoro-1,3-bis(1-fluoro-2-methoxyethyl)-4,4,5-tripropylimidazolidine |
|---|---|
| PubChem CID | 139932609 |
| Molecular Formula | C18H34F4N2O2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 2,2-difluoro-1,3-bis(1-fluoro-2-methoxyethyl)-4,4,5-tripropylimidazolidine |
| SMILES | CCCC1N(C(F)COC)C(F)(F)N(C(F)COC)C1(CCC)CCC |
| InChI | InChI=1S/C18H34F4N2O2/c1-6-9-14-17(10-7-2,11-8-3)24(16(20)13-26-5)18(21,22)23(14)15(19)12-25-4/h14-16H,6-13H2,1-5H3 |
| InChIKey | PDZYIBVZZOHQDE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|