About 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine
2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine (PubChem CID 139932612) has the molecular formula C9H12F8N2O2
and a molecular weight of 332.19 g/mol. Its IUPAC name is 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine.
Molecular Properties
| Compound Name | 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine |
| PubChem CID | 139932612 |
| Molecular Formula | C9H12F8N2O2 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine |
| SMILES | FC(F)(F)OCCN1CCN(CCOC(F)(F)F)C1(F)F |
| InChI | InChI=1S/C9H12F8N2O2/c10-7(11,12)20-5-3-18-1-2-19(9(18,16)17)4-6-21-8(13,14)15/h1-6H2 |
| InChIKey | CMPMVLJBWJSHJO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine?
The IUPAC name of 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine (CID 139932612) is 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine.
What is the SMILES notation for 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine?
The canonical SMILES for 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine is FC(F)(F)OCCN1CCN(CCOC(F)(F)F)C1(F)F.
What is the InChIKey of 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine?
The InChIKey is CMPMVLJBWJSHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F8N2O2/c10-7(11,12)20-5-3-18-1-2-19(9(18,16)17)4-6-21-8(13,14)15/h1-6H2.
What are the key properties of 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine?
2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine has a molecular weight of 332.19 g/mol, XLogP of 2.23, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-1,3-bis[2-(trifluoromethoxy)ethyl]imidazolidine is sourced from PubChem (CID 139932612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).