C23H46F2N2O2 — CID 139932621
4,4,5,5-tetraethyl-2,2-difluoro-1,3-bis(2-methoxypentan-3-yl)imidazolidine (PubChem CID 139932621) has the molecular formula C23H46F2N2O2 and a molecular weight of 420.63 g/mol. Its IUPAC name is 4,4,5,5-tetraethyl-2,2-difluoro-1,3-bis(2-methoxypentan-3-yl)imidazolidine.
| Compound Name | 4,4,5,5-tetraethyl-2,2-difluoro-1,3-bis(2-methoxypentan-3-yl)imidazolidine |
|---|---|
| PubChem CID | 139932621 |
| Molecular Formula | C23H46F2N2O2 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | 4,4,5,5-tetraethyl-2,2-difluoro-1,3-bis(2-methoxypentan-3-yl)imidazolidine |
| SMILES | CCC(C(C)OC)N1C(F)(F)N(C(CC)C(C)OC)C(CC)(CC)C1(CC)CC |
| InChI | InChI=1S/C23H46F2N2O2/c1-11-19(17(7)28-9)26-21(13-3,14-4)22(15-5,16-6)27(23(26,24)25)20(12-2)18(8)29-10/h17-20H,11-16H2,1-10H3 |
| InChIKey | SWZVCFAVJJHXBT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|