C18H36F2N2O2 — CID 139932632
2,2-difluoro-1,3-bis(2-methoxyethyl)-4,4,5-tripropylimidazolidine (PubChem CID 139932632) has the molecular formula C18H36F2N2O2 and a molecular weight of 350.49 g/mol. Its IUPAC name is 2,2-difluoro-1,3-bis(2-methoxyethyl)-4,4,5-tripropylimidazolidine.
| Compound Name | 2,2-difluoro-1,3-bis(2-methoxyethyl)-4,4,5-tripropylimidazolidine |
|---|---|
| PubChem CID | 139932632 |
| Molecular Formula | C18H36F2N2O2 |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 2,2-difluoro-1,3-bis(2-methoxyethyl)-4,4,5-tripropylimidazolidine |
| SMILES | CCCC1N(CCOC)C(F)(F)N(CCOC)C1(CCC)CCC |
| InChI | InChI=1S/C18H36F2N2O2/c1-6-9-16-17(10-7-2,11-8-3)22(13-15-24-5)18(19,20)21(16)12-14-23-4/h16H,6-15H2,1-5H3 |
| InChIKey | RSBQGCIKLVBRSW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|