C21H40F4N2O2 — CID 139932641
2,2-difluoro-1,3-bis(1-fluoro-2-methoxyethyl)-4,4,5,5-tetrapropylimidazolidine (PubChem CID 139932641) has the molecular formula C21H40F4N2O2 and a molecular weight of 428.56 g/mol. Its IUPAC name is 2,2-difluoro-1,3-bis(1-fluoro-2-methoxyethyl)-4,4,5,5-tetrapropylimidazolidine.
| Compound Name | 2,2-difluoro-1,3-bis(1-fluoro-2-methoxyethyl)-4,4,5,5-tetrapropylimidazolidine |
|---|---|
| PubChem CID | 139932641 |
| Molecular Formula | C21H40F4N2O2 |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | 2,2-difluoro-1,3-bis(1-fluoro-2-methoxyethyl)-4,4,5,5-tetrapropylimidazolidine |
| SMILES | CCCC1(CCC)N(C(F)COC)C(F)(F)N(C(F)COC)C1(CCC)CCC |
| InChI | InChI=1S/C21H40F4N2O2/c1-7-11-19(12-8-2)20(13-9-3,14-10-4)27(18(23)16-29-6)21(24,25)26(19)17(22)15-28-5/h17-18H,7-16H2,1-6H3 |
| InChIKey | UKEIAFKDHUYCKJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|