C17H34F2N2O2 — CID 139932747
2,2-difluoro-1-(2-methoxyethyl)-3-(4-methoxy-2,3,4,5-tetramethylhexan-3-yl)imidazolidine (PubChem CID 139932747) has the molecular formula C17H34F2N2O2 and a molecular weight of 336.47 g/mol. Its IUPAC name is 2,2-difluoro-1-(2-methoxyethyl)-3-(4-methoxy-2,3,4,5-tetramethylhexan-3-yl)imidazolidine.
| Compound Name | 2,2-difluoro-1-(2-methoxyethyl)-3-(4-methoxy-2,3,4,5-tetramethylhexan-3-yl)imidazolidine |
|---|---|
| PubChem CID | 139932747 |
| Molecular Formula | C17H34F2N2O2 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 2,2-difluoro-1-(2-methoxyethyl)-3-(4-methoxy-2,3,4,5-tetramethylhexan-3-yl)imidazolidine |
| SMILES | COCCN1CCN(C(C)(C(C)C)C(C)(OC)C(C)C)C1(F)F |
| InChI | InChI=1S/C17H34F2N2O2/c1-13(2)15(5,16(6,23-8)14(3)4)21-10-9-20(11-12-22-7)17(21,18)19/h13-14H,9-12H2,1-8H3 |
| InChIKey | ZPIKGWHDOJQXJD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|