About methyl 3-hydroxyoct-2-enoate
methyl 3-hydroxyoct-2-enoate (PubChem CID 139933241) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is methyl 3-hydroxyoct-2-enoate.
Molecular Properties
| Compound Name | methyl 3-hydroxyoct-2-enoate |
| PubChem CID | 139933241 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | methyl 3-hydroxyoct-2-enoate |
| SMILES | CCCCCC(O)=CC(=O)OC |
| InChI | InChI=1S/C9H16O3/c1-3-4-5-6-8(10)7-9(11)12-2/h7,10H,3-6H2,1-2H3 |
| InChIKey | XDKDFGFECHOOSE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-hydroxyoct-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-hydroxyoct-2-enoate?
The IUPAC name of methyl 3-hydroxyoct-2-enoate (CID 139933241) is methyl 3-hydroxyoct-2-enoate.
What is the SMILES notation for methyl 3-hydroxyoct-2-enoate?
The canonical SMILES for methyl 3-hydroxyoct-2-enoate is CCCCCC(O)=CC(=O)OC.
What is the InChIKey of methyl 3-hydroxyoct-2-enoate?
The InChIKey is XDKDFGFECHOOSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-3-4-5-6-8(10)7-9(11)12-2/h7,10H,3-6H2,1-2H3.
What are the key properties of methyl 3-hydroxyoct-2-enoate?
methyl 3-hydroxyoct-2-enoate has a molecular weight of 172.22 g/mol, XLogP of 2.18, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-hydroxyoct-2-enoate is sourced from PubChem (CID 139933241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).