C13H16O7 — CID 139933244
4-[2-(2-methylprop-2-enoyloxy)-3-oxopent-4-enoxy]-4-oxobutanoic acid (PubChem CID 139933244) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is 4-[2-(2-methylprop-2-enoyloxy)-3-oxopent-4-enoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-(2-methylprop-2-enoyloxy)-3-oxopent-4-enoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139933244 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-[2-(2-methylprop-2-enoyloxy)-3-oxopent-4-enoxy]-4-oxobutanoic acid |
| SMILES | C=CC(=O)C(COC(=O)CCC(=O)O)OC(=O)C(=C)C |
| InChI | InChI=1S/C13H16O7/c1-4-9(14)10(20-13(18)8(2)3)7-19-12(17)6-5-11(15)16/h4,10H,1-2,5-7H2,3H3,(H,15,16) |
| InChIKey | VCOHIQJSLSBTRH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|