C41H47NO4SSi — CID 139933323
trityl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(2R)-1-phenyl-1-sulfanylidenepropan-2-yl]azetidin-1-yl]acetate (PubChem CID 139933323) has the molecular formula C41H47NO4SSi and a molecular weight of 677.98 g/mol. Its IUPAC name is trityl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(2R)-1-phenyl-1-sulfanylidenepropan-2-yl]azetidin-1-yl]acetate.
| Compound Name | trityl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(2R)-1-phenyl-1-sulfanylidenepropan-2-yl]azetidin-1-yl]acetate |
|---|---|
| PubChem CID | 139933323 |
| Molecular Formula | C41H47NO4SSi |
| Molecular Weight | 677.98 g/mol |
| Exact Mass | 677.30 |
| IUPAC Name | trityl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(2R)-1-phenyl-1-sulfanylidenepropan-2-yl]azetidin-1-yl]acetate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N(CC(=O)OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1[C@@H](C)C(=S)c1ccccc1 |
| InChI | InChI=1S/C41H47NO4SSi/c1-29(38(47)31-20-12-8-13-21-31)37-36(30(2)46-48(6,7)40(3,4)5)39(44)42(37)28-35(43)45-41(32-22-14-9-15-23-32,33-24-16-10-17-25-33)34-26-18-11-19-27-34/h8-27,29-30,36-37H,28H2,1-7H3/t29-,30-,36-,37-/m1/s1 |
| InChIKey | ZUNWMOADWDNIHZ-QTZOMSRISA-N |
| XLogP | 8.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.98 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|