C17H21NO4S — CID 139933324
2-[(2S,3S)-3-[(1R)-1-hydroxyethyl]-2-[(2R)-1-(4-methylphenyl)-1-sulfanylidenepropan-2-yl]-4-oxoazetidin-1-yl]acetic acid (PubChem CID 139933324) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-[(2S,3S)-3-[(1R)-1-hydroxyethyl]-2-[(2R)-1-(4-methylphenyl)-1-sulfanylidenepropan-2-yl]-4-oxoazetidin-1-yl]acetic acid.
| Compound Name | 2-[(2S,3S)-3-[(1R)-1-hydroxyethyl]-2-[(2R)-1-(4-methylphenyl)-1-sulfanylidenepropan-2-yl]-4-oxoazetidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 139933324 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[(2S,3S)-3-[(1R)-1-hydroxyethyl]-2-[(2R)-1-(4-methylphenyl)-1-sulfanylidenepropan-2-yl]-4-oxoazetidin-1-yl]acetic acid |
| SMILES | Cc1ccc(C(=S)[C@H](C)[C@@H]2[C@@H]([C@@H](C)O)C(=O)N2CC(=O)O)cc1 |
| InChI | InChI=1S/C17H21NO4S/c1-9-4-6-12(7-5-9)16(23)10(2)15-14(11(3)19)17(22)18(15)8-13(20)21/h4-7,10-11,14-15,19H,8H2,1-3H3,(H,20,21)/t10-,11-,14-,15-/m1/s1 |
| InChIKey | OZAIUWVBGZVFRT-YIKOMLBNSA-N |
| XLogP | 1.64 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|