About 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one
3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one (PubChem CID 139933953) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one.
Molecular Properties
| Compound Name | 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one |
| PubChem CID | 139933953 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one |
| SMILES | CN(C)CCC1C(=O)OC(O)C1O |
| InChI | InChI=1S/C8H15NO4/c1-9(2)4-3-5-6(10)8(12)13-7(5)11/h5-6,8,10,12H,3-4H2,1-2H3 |
| InChIKey | AGLRDHNAWBHGGJ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one?
The IUPAC name of 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one (CID 139933953) is 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one.
What is the SMILES notation for 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one?
The canonical SMILES for 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one is CN(C)CCC1C(=O)OC(O)C1O.
What is the InChIKey of 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one?
The InChIKey is AGLRDHNAWBHGGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4/c1-9(2)4-3-5-6(10)8(12)13-7(5)11/h5-6,8,10,12H,3-4H2,1-2H3.
What are the key properties of 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one?
3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one has a molecular weight of 189.21 g/mol, XLogP of -1.21, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(dimethylamino)ethyl]-4,5-dihydroxyoxolan-2-one is sourced from PubChem (CID 139933953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).