C14H21N3O — CID 139934710
3-(3-piperidin-1-ylpropyl)-1H-2,1,3-benzoxadiazole (PubChem CID 139934710) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-(3-piperidin-1-ylpropyl)-1H-2,1,3-benzoxadiazole.
| Compound Name | 3-(3-piperidin-1-ylpropyl)-1H-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 139934710 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 3-(3-piperidin-1-ylpropyl)-1H-2,1,3-benzoxadiazole |
| SMILES | c1ccc2c(c1)NON2CCCN1CCCCC1 |
| InChI | InChI=1S/C14H21N3O/c1-4-9-16(10-5-1)11-6-12-17-14-8-3-2-7-13(14)15-18-17/h2-3,7-8,15H,1,4-6,9-12H2 |
| InChIKey | CTCQACLUZGWLAC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |