C17H26N4O7 — CID 139935837
[(1R,2R)-2-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxycyclohexyl]urea (PubChem CID 139935837) has the molecular formula C17H26N4O7 and a molecular weight of 398.42 g/mol. Its IUPAC name is [(1R,2R)-2-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxycyclohexyl]urea.
| Compound Name | [(1R,2R)-2-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxycyclohexyl]urea |
|---|---|
| PubChem CID | 139935837 |
| Molecular Formula | C17H26N4O7 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [(1R,2R)-2-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxycyclohexyl]urea |
| SMILES | Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O[C@@H]2CCCC[C@H]2NC(N)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H26N4O7/c1-8-6-21(17(26)20-14(8)24)15-13(12(23)11(7-22)28-15)27-10-5-3-2-4-9(10)19-16(18)25/h6,9-13,15,22-23H,2-5,7H2,1H3,(H3,18,19,25)(H,20,24,26)/t9-,10-,11-,12-,13-,15-/m1/s1 |
| InChIKey | MRJJQUDJCVFYER-QTPLKFIXSA-N |
| XLogP | -1.54 |
| TPSA | 168.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |