C10H16O3S — CID 139935925
(1E,3Z)-2,3-dimethylcycloocta-1,3-diene-1-sulfonic acid (PubChem CID 139935925) has the molecular formula C10H16O3S and a molecular weight of 216.30 g/mol. Its IUPAC name is (1E,3Z)-2,3-dimethylcycloocta-1,3-diene-1-sulfonic acid.
| Compound Name | (1E,3Z)-2,3-dimethylcycloocta-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 139935925 |
| Molecular Formula | C10H16O3S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (1E,3Z)-2,3-dimethylcycloocta-1,3-diene-1-sulfonic acid |
| SMILES | CC1=C/CCCC/C(S(=O)(=O)O)=C\1C |
| InChI | InChI=1S/C10H16O3S/c1-8-6-4-3-5-7-10(9(8)2)14(11,12)13/h6H,3-5,7H2,1-2H3,(H,11,12,13)/b8-6-,10-9+ |
| InChIKey | LQTWDBKGWXVWDI-JWJWWGMXSA-N |
| XLogP | 2.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|