C28H36F2N2O2 — CID 139936298
1-[8-fluoro-5-(4-fluorophenyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-(4-pentoxypiperidin-1-yl)ethanone (PubChem CID 139936298) has the molecular formula C28H36F2N2O2 and a molecular weight of 470.60 g/mol. Its IUPAC name is 1-[8-fluoro-5-(4-fluorophenyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-(4-pentoxypiperidin-1-yl)ethanone.
| Compound Name | 1-[8-fluoro-5-(4-fluorophenyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-(4-pentoxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 139936298 |
| Molecular Formula | C28H36F2N2O2 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 1-[8-fluoro-5-(4-fluorophenyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-(4-pentoxypiperidin-1-yl)ethanone |
| SMILES | CCCCCOC1CCN(CC(=O)N2CCCC(c3ccc(F)cc3)c3ccc(F)cc32)CC1 |
| InChI | InChI=1S/C28H36F2N2O2/c1-2-3-4-18-34-24-13-16-31(17-14-24)20-28(33)32-15-5-6-25(21-7-9-22(29)10-8-21)26-12-11-23(30)19-27(26)32/h7-12,19,24-25H,2-6,13-18,20H2,1H3 |
| InChIKey | MXFJXKQCQJZUBU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|