C24H43NO6 — CID 139936753
(2S)-2-[di(decanoyl)amino]butanedioic acid (PubChem CID 139936753) has the molecular formula C24H43NO6 and a molecular weight of 441.61 g/mol. Its IUPAC name is (2S)-2-[di(decanoyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[di(decanoyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 139936753 |
| Molecular Formula | C24H43NO6 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | (2S)-2-[di(decanoyl)amino]butanedioic acid |
| SMILES | CCCCCCCCCC(=O)N(C(=O)CCCCCCCCC)[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H43NO6/c1-3-5-7-9-11-13-15-17-21(26)25(20(24(30)31)19-23(28)29)22(27)18-16-14-12-10-8-6-4-2/h20H,3-19H2,1-2H3,(H,28,29)(H,30,31)/t20-/m0/s1 |
| InChIKey | FAIRPNJDNYNNAV-FQEVSTJZSA-N |
| XLogP | 5.55 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|