About tert-butyl 3-oxofuran-2-carboxylate
tert-butyl 3-oxofuran-2-carboxylate (PubChem CID 139936949) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is tert-butyl 3-oxofuran-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-oxofuran-2-carboxylate |
| PubChem CID | 139936949 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | tert-butyl 3-oxofuran-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1OC=CC1=O |
| InChI | InChI=1S/C9H12O4/c1-9(2,3)13-8(11)7-6(10)4-5-12-7/h4-5,7H,1-3H3 |
| InChIKey | BTPNYBSUHFJAPT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-oxofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-oxofuran-2-carboxylate?
The IUPAC name of tert-butyl 3-oxofuran-2-carboxylate (CID 139936949) is tert-butyl 3-oxofuran-2-carboxylate.
What is the SMILES notation for tert-butyl 3-oxofuran-2-carboxylate?
The canonical SMILES for tert-butyl 3-oxofuran-2-carboxylate is CC(C)(C)OC(=O)C1OC=CC1=O.
What is the InChIKey of tert-butyl 3-oxofuran-2-carboxylate?
The InChIKey is BTPNYBSUHFJAPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-9(2,3)13-8(11)7-6(10)4-5-12-7/h4-5,7H,1-3H3.
What are the key properties of tert-butyl 3-oxofuran-2-carboxylate?
tert-butyl 3-oxofuran-2-carboxylate has a molecular weight of 184.19 g/mol, XLogP of 0.81, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-oxofuran-2-carboxylate is sourced from PubChem (CID 139936949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).