C24H27ClN2O7S — CID 139937818
4'-(4-chlorophenyl)sulfonyl-6'-[2-(dipropylamino)ethyl]spiro[1,3-dioxolane-2,2'-3H-1,4-benzoxazine]-4,5-dione (PubChem CID 139937818) has the molecular formula C24H27ClN2O7S and a molecular weight of 523.01 g/mol. Its IUPAC name is 4'-(4-chlorophenyl)sulfonyl-6'-[2-(dipropylamino)ethyl]spiro[1,3-dioxolane-2,2'-3H-1,4-benzoxazine]-4,5-dione.
| Compound Name | 4'-(4-chlorophenyl)sulfonyl-6'-[2-(dipropylamino)ethyl]spiro[1,3-dioxolane-2,2'-3H-1,4-benzoxazine]-4,5-dione |
|---|---|
| PubChem CID | 139937818 |
| Molecular Formula | C24H27ClN2O7S |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 4'-(4-chlorophenyl)sulfonyl-6'-[2-(dipropylamino)ethyl]spiro[1,3-dioxolane-2,2'-3H-1,4-benzoxazine]-4,5-dione |
| SMILES | CCCN(CCC)CCc1ccc2c(c1)N(S(=O)(=O)c1ccc(Cl)cc1)CC1(OC(=O)C(=O)O1)O2 |
| InChI | InChI=1S/C24H27ClN2O7S/c1-3-12-26(13-4-2)14-11-17-5-10-21-20(15-17)27(16-24(32-21)33-22(28)23(29)34-24)35(30,31)19-8-6-18(25)7-9-19/h5-10,15H,3-4,11-14,16H2,1-2H3 |
| InChIKey | WDUMIOUNQONVKR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|