C25H33N5O5 — CID 139937993
3-[[2-[[4-(benzylcarbamoylamino)-1-methylpyrrole-2-carbonyl]amino]acetyl]amino]-3-cyclohexylpropanoic acid (PubChem CID 139937993) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is 3-[[2-[[4-(benzylcarbamoylamino)-1-methylpyrrole-2-carbonyl]amino]acetyl]amino]-3-cyclohexylpropanoic acid.
| Compound Name | 3-[[2-[[4-(benzylcarbamoylamino)-1-methylpyrrole-2-carbonyl]amino]acetyl]amino]-3-cyclohexylpropanoic acid |
|---|---|
| PubChem CID | 139937993 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 3-[[2-[[4-(benzylcarbamoylamino)-1-methylpyrrole-2-carbonyl]amino]acetyl]amino]-3-cyclohexylpropanoic acid |
| SMILES | Cn1cc(NC(=O)NCc2ccccc2)cc1C(=O)NCC(=O)NC(CC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C25H33N5O5/c1-30-16-19(28-25(35)27-14-17-8-4-2-5-9-17)12-21(30)24(34)26-15-22(31)29-20(13-23(32)33)18-10-6-3-7-11-18/h2,4-5,8-9,12,16,18,20H,3,6-7,10-11,13-15H2,1H3,(H,26,34)(H,29,31)(H,32,33)(H2,27,28,35) |
| InChIKey | BAIQNBWCAKKOQA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 141.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |