About 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide
2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide (PubChem CID 139938220) has the molecular formula C15H18N2O5S
and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide.
Molecular Properties
| Compound Name | 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide |
| PubChem CID | 139938220 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide |
| SMILES | COc1cc(S(N)(=O)=O)c(-c2ccc(N)cc2)c(OC)c1OC |
| InChI | InChI=1S/C15H18N2O5S/c1-20-11-8-12(23(17,18)19)13(15(22-3)14(11)21-2)9-4-6-10(16)7-5-9/h4-8H,16H2,1-3H3,(H2,17,18,19) |
| InChIKey | KCWZUPPSKKSIAK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide?
The IUPAC name of 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide (CID 139938220) is 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide.
What is the SMILES notation for 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide?
The canonical SMILES for 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide is COc1cc(S(N)(=O)=O)c(-c2ccc(N)cc2)c(OC)c1OC.
What is the InChIKey of 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide?
The InChIKey is KCWZUPPSKKSIAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O5S/c1-20-11-8-12(23(17,18)19)13(15(22-3)14(11)21-2)9-4-6-10(16)7-5-9/h4-8H,16H2,1-3H3,(H2,17,18,19).
What are the key properties of 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide?
2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide has a molecular weight of 338.39 g/mol, XLogP of 1.61, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminophenyl)-3,4,5-trimethoxybenzenesulfonamide is sourced from PubChem (CID 139938220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).