C12H21NO3S — CID 139938298
4-methyl-2-(1-sulfanylpropylcarbamoyl)cyclohexane-1-carboxylic acid (PubChem CID 139938298) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is 4-methyl-2-(1-sulfanylpropylcarbamoyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-methyl-2-(1-sulfanylpropylcarbamoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 139938298 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-methyl-2-(1-sulfanylpropylcarbamoyl)cyclohexane-1-carboxylic acid |
| SMILES | CCC(S)NC(=O)C1CC(C)CCC1C(=O)O |
| InChI | InChI=1S/C12H21NO3S/c1-3-10(17)13-11(14)9-6-7(2)4-5-8(9)12(15)16/h7-10,17H,3-6H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | QGVQVKGGSCAABQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|