C21H24N4S2 — CID 139938427
7,10-dimethyl-3-(2-piperidin-4-ylethyl)-4-thiophen-2-yl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene (PubChem CID 139938427) has the molecular formula C21H24N4S2 and a molecular weight of 396.59 g/mol. Its IUPAC name is 7,10-dimethyl-3-(2-piperidin-4-ylethyl)-4-thiophen-2-yl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene.
| Compound Name | 7,10-dimethyl-3-(2-piperidin-4-ylethyl)-4-thiophen-2-yl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139938427 |
| Molecular Formula | C21H24N4S2 |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 7,10-dimethyl-3-(2-piperidin-4-ylethyl)-4-thiophen-2-yl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
| SMILES | Cc1csc2c1nc(C)c1nc(-c3cccs3)n(CCC3CCNCC3)c12 |
| InChI | InChI=1S/C21H24N4S2/c1-13-12-27-20-17(13)23-14(2)18-19(20)25(10-7-15-5-8-22-9-6-15)21(24-18)16-4-3-11-26-16/h3-4,11-12,15,22H,5-10H2,1-2H3 |
| InChIKey | GHISRJNJSWXBSE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |