C13H30ClN2OP — CID 139938439
1-chlorophosphanyloxy-N,N,N',N'-tetra(propan-2-yl)methanediamine (PubChem CID 139938439) has the molecular formula C13H30ClN2OP and a molecular weight of 296.82 g/mol. Its IUPAC name is 1-chlorophosphanyloxy-N,N,N',N'-tetra(propan-2-yl)methanediamine.
| Compound Name | 1-chlorophosphanyloxy-N,N,N',N'-tetra(propan-2-yl)methanediamine |
|---|---|
| PubChem CID | 139938439 |
| Molecular Formula | C13H30ClN2OP |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-chlorophosphanyloxy-N,N,N',N'-tetra(propan-2-yl)methanediamine |
| SMILES | CC(C)N(C(C)C)C(OPCl)N(C(C)C)C(C)C |
| InChI | InChI=1S/C13H30ClN2OP/c1-9(2)15(10(3)4)13(17-18-14)16(11(5)6)12(7)8/h9-13,18H,1-8H3 |
| InChIKey | VPBYAGGRRVURCW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|