C19H24N2O — CID 139938842
N-(5,7-dimethylquinolin-3-yl)-1-methylcyclohexane-1-carboxamide (PubChem CID 139938842) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is N-(5,7-dimethylquinolin-3-yl)-1-methylcyclohexane-1-carboxamide.
| Compound Name | N-(5,7-dimethylquinolin-3-yl)-1-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 139938842 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | N-(5,7-dimethylquinolin-3-yl)-1-methylcyclohexane-1-carboxamide |
| SMILES | Cc1cc(C)c2cc(NC(=O)C3(C)CCCCC3)cnc2c1 |
| InChI | InChI=1S/C19H24N2O/c1-13-9-14(2)16-11-15(12-20-17(16)10-13)21-18(22)19(3)7-5-4-6-8-19/h9-12H,4-8H2,1-3H3,(H,21,22) |
| InChIKey | KKGSTFRNTLUXKR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |