About magnesium;2,2-dimethylpropan-1-olate;propan-1-olate
magnesium;2,2-dimethylpropan-1-olate;propan-1-olate (PubChem CID 139939049) has the molecular formula C8H18MgO2
and a molecular weight of 170.53 g/mol. Its IUPAC name is magnesium;2,2-dimethylpropan-1-olate;propan-1-olate.
Molecular Properties
| Compound Name | magnesium;2,2-dimethylpropan-1-olate;propan-1-olate |
| PubChem CID | 139939049 |
| Molecular Formula | C8H18MgO2 |
| Molecular Weight | 170.53 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | magnesium;2,2-dimethylpropan-1-olate;propan-1-olate |
| SMILES | CC(C)(C)C[O-].CCC[O-].[Mg+2] |
| InChI | InChI=1S/C5H11O.C3H7O.Mg/c1-5(2,3)4-6;1-2-3-4;/h4H2,1-3H3;2-3H2,1H3;/q2*-1;+2 |
| InChIKey | PGPOEKLEHJFASV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.53 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze magnesium;2,2-dimethylpropan-1-olate;propan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2,2-dimethylpropan-1-olate;propan-1-olate?
The IUPAC name of magnesium;2,2-dimethylpropan-1-olate;propan-1-olate (CID 139939049) is magnesium;2,2-dimethylpropan-1-olate;propan-1-olate.
What is the SMILES notation for magnesium;2,2-dimethylpropan-1-olate;propan-1-olate?
The canonical SMILES for magnesium;2,2-dimethylpropan-1-olate;propan-1-olate is CC(C)(C)C[O-].CCC[O-].[Mg+2].
What is the InChIKey of magnesium;2,2-dimethylpropan-1-olate;propan-1-olate?
The InChIKey is PGPOEKLEHJFASV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O.C3H7O.Mg/c1-5(2,3)4-6;1-2-3-4;/h4H2,1-3H3;2-3H2,1H3;/q2*-1;+2.
What are the key properties of magnesium;2,2-dimethylpropan-1-olate;propan-1-olate?
magnesium;2,2-dimethylpropan-1-olate;propan-1-olate has a molecular weight of 170.53 g/mol, XLogP of -0.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2,2-dimethylpropan-1-olate;propan-1-olate is sourced from PubChem (CID 139939049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).