C19H28N2O7S — CID 139939271
tert-butyl 7-[3-(benzenesulfonamido)propyl]-5,6-dihydro-3aH-[1,3]dioxolo[4,5-b][1,4]oxazine-7a-carboxylate (PubChem CID 139939271) has the molecular formula C19H28N2O7S and a molecular weight of 428.51 g/mol. Its IUPAC name is tert-butyl 7-[3-(benzenesulfonamido)propyl]-5,6-dihydro-3aH-[1,3]dioxolo[4,5-b][1,4]oxazine-7a-carboxylate.
| Compound Name | tert-butyl 7-[3-(benzenesulfonamido)propyl]-5,6-dihydro-3aH-[1,3]dioxolo[4,5-b][1,4]oxazine-7a-carboxylate |
|---|---|
| PubChem CID | 139939271 |
| Molecular Formula | C19H28N2O7S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | tert-butyl 7-[3-(benzenesulfonamido)propyl]-5,6-dihydro-3aH-[1,3]dioxolo[4,5-b][1,4]oxazine-7a-carboxylate |
| SMILES | CC(C)(C)OC(=O)C12OCOC1OCCN2CCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H28N2O7S/c1-18(2,3)28-16(22)19-17(26-14-27-19)25-13-12-21(19)11-7-10-20-29(23,24)15-8-5-4-6-9-15/h4-6,8-9,17,20H,7,10-14H2,1-3H3 |
| InChIKey | LZTVTENNJOWBPA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|