C12H11F3O2 — CID 139939295
3-(hydroxymethyl)-4-(2,3,4-trifluorophenyl)cyclopentan-1-one (PubChem CID 139939295) has the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is 3-(hydroxymethyl)-4-(2,3,4-trifluorophenyl)cyclopentan-1-one.
| Compound Name | 3-(hydroxymethyl)-4-(2,3,4-trifluorophenyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 139939295 |
| Molecular Formula | C12H11F3O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-(hydroxymethyl)-4-(2,3,4-trifluorophenyl)cyclopentan-1-one |
| SMILES | O=C1CC(CO)C(c2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C12H11F3O2/c13-10-2-1-8(11(14)12(10)15)9-4-7(17)3-6(9)5-16/h1-2,6,9,16H,3-5H2 |
| InChIKey | RGFSMSUUQDMUPC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|